C27H32N4O3S — CID 87980028
1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(1,3-oxazol-5-yl)phenyl]thiourea (PubChem CID 87980028) has the molecular formula C27H32N4O3S and a molecular weight of 492.65 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(1,3-oxazol-5-yl)phenyl]thiourea.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(1,3-oxazol-5-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 87980028 |
| Molecular Formula | C27H32N4O3S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(1,3-oxazol-5-yl)phenyl]thiourea |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=S)Nc4ccc(-c5cnco5)cc4)C[C@@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C27H32N4O3S/c1-31-13-12-27(19-6-9-22(32-2)23(14-19)33-3)11-10-21(15-25(27)31)30-26(35)29-20-7-4-18(5-8-20)24-16-28-17-34-24/h4-9,14,16-17,21,25H,10-13,15H2,1-3H3,(H2,29,30,35)/t21-,25+,27+/m1/s1 |
| InChIKey | PUJQPOCXVOGXBN-UDZXTKBFSA-N |
| XLogP | 4.84 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|