C24H39N3O2S — CID 11364833
1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-hexylthiourea (PubChem CID 11364833) has the molecular formula C24H39N3O2S and a molecular weight of 433.66 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-hexylthiourea.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-hexylthiourea |
|---|---|
| PubChem CID | 11364833 |
| Molecular Formula | C24H39N3O2S |
| Molecular Weight | 433.66 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-hexylthiourea |
| SMILES | CCCCCCNC(=S)N[C@@H]1CC[C@@]2(c3ccc(OC)c(OC)c3)CCN(C)[C@H]2C1 |
| InChI | InChI=1S/C24H39N3O2S/c1-5-6-7-8-14-25-23(30)26-19-11-12-24(13-15-27(2)22(24)17-19)18-9-10-20(28-3)21(16-18)29-4/h9-10,16,19,22H,5-8,11-15,17H2,1-4H3,(H2,25,26,30)/t19-,22+,24+/m1/s1 |
| InChIKey | HBFQALPEZFYFSP-UCFCWBNQSA-N |
| XLogP | 4.24 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.66 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|