C28H43N3O4S — CID 11157941
ethyl 2-[[(3aS,6R,7aS)-6-(butylcarbamothioylamino)-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]cyclopropane-1-carboxylate (PubChem CID 11157941) has the molecular formula C28H43N3O4S and a molecular weight of 517.74 g/mol. Its IUPAC name is ethyl 2-[[(3aS,6R,7aS)-6-(butylcarbamothioylamino)-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-[[(3aS,6R,7aS)-6-(butylcarbamothioylamino)-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11157941 |
| Molecular Formula | C28H43N3O4S |
| Molecular Weight | 517.74 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | ethyl 2-[[(3aS,6R,7aS)-6-(butylcarbamothioylamino)-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]cyclopropane-1-carboxylate |
| SMILES | CCCCNC(=S)N[C@@H]1CC[C@@]2(c3ccc(OC)c(OC)c3)CCN(CC3CC3C(=O)OCC)[C@H]2C1 |
| InChI | InChI=1S/C28H43N3O4S/c1-5-7-13-29-27(36)30-21-10-11-28(20-8-9-23(33-3)24(16-20)34-4)12-14-31(25(28)17-21)18-19-15-22(19)26(32)35-6-2/h8-9,16,19,21-22,25H,5-7,10-15,17-18H2,1-4H3,(H2,29,30,36)/t19?,21-,22?,25+,28+/m1/s1 |
| InChIKey | CMCIUMZLXUISTL-UAPBDEKISA-N |
| XLogP | 4.03 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.74 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|