C33H41N3O2S — CID 72759062
1-[3a-(3,4-dimethoxyphenyl)-1-(3-phenylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-benzylthiourea (PubChem CID 72759062) has the molecular formula C33H41N3O2S and a molecular weight of 543.78 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-(3-phenylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-benzylthiourea.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-(3-phenylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-benzylthiourea |
|---|---|
| PubChem CID | 72759062 |
| Molecular Formula | C33H41N3O2S |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-(3-phenylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-benzylthiourea |
| SMILES | COc1ccc(C23CCC(NC(=S)NCc4ccccc4)CC2N(CCCc2ccccc2)CC3)cc1OC |
| InChI | InChI=1S/C33H41N3O2S/c1-37-29-16-15-27(22-30(29)38-2)33-18-17-28(35-32(39)34-24-26-12-7-4-8-13-26)23-31(33)36(21-19-33)20-9-14-25-10-5-3-6-11-25/h3-8,10-13,15-16,22,28,31H,9,14,17-21,23-24H2,1-2H3,(H2,34,35,39) |
| InChIKey | WSWXCLMJZWBVFC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|