C22H33ClN2O3 — CID 171567453
N-[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-5-chloropentanamide (PubChem CID 171567453) has the molecular formula C22H33ClN2O3 and a molecular weight of 408.97 g/mol. Its IUPAC name is N-[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-5-chloropentanamide.
| Compound Name | N-[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-5-chloropentanamide |
|---|---|
| PubChem CID | 171567453 |
| Molecular Formula | C22H33ClN2O3 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-5-chloropentanamide |
| SMILES | COc1ccc([C@@]23CCC(NC(=O)CCCCCl)C[C@@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C22H33ClN2O3/c1-25-13-11-22(16-7-8-18(27-2)19(14-16)28-3)10-9-17(15-20(22)25)24-21(26)6-4-5-12-23/h7-8,14,17,20H,4-6,9-13,15H2,1-3H3,(H,24,26)/t17?,20-,22-/m0/s1 |
| InChIKey | ZGPVPXDHKHQTHM-FYQYPFLCSA-N |
| XLogP | 3.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|