C25H32ClN3O3 — CID 91276777
3-[(3aS,6R,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-1-(4-chlorophenyl)-1-methylurea (PubChem CID 91276777) has the molecular formula C25H32ClN3O3 and a molecular weight of 458.00 g/mol. Its IUPAC name is 3-[(3aS,6R,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-1-(4-chlorophenyl)-1-methylurea.
| Compound Name | 3-[(3aS,6R,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-1-(4-chlorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 91276777 |
| Molecular Formula | C25H32ClN3O3 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 3-[(3aS,6R,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-1-(4-chlorophenyl)-1-methylurea |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)N(C)c4ccc(Cl)cc4)C[C@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C25H32ClN3O3/c1-28-14-13-25(17-5-10-21(31-3)22(15-17)32-4)12-11-19(16-23(25)28)27-24(30)29(2)20-8-6-18(26)7-9-20/h5-10,15,19,23H,11-14,16H2,1-4H3,(H,27,30)/t19-,23-,25+/m1/s1 |
| InChIKey | LVMSGFOMPUOMBZ-NIDLKEISSA-N |
| XLogP | 4.70 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |