C27H35N3O2S — CID 91302453
1-[(3aS,6R,7aR)-3a-(1,3-benzodioxol-5-yl)-1-benzyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-tert-butylthiourea (PubChem CID 91302453) has the molecular formula C27H35N3O2S and a molecular weight of 465.66 g/mol. Its IUPAC name is 1-[(3aS,6R,7aR)-3a-(1,3-benzodioxol-5-yl)-1-benzyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-tert-butylthiourea.
| Compound Name | 1-[(3aS,6R,7aR)-3a-(1,3-benzodioxol-5-yl)-1-benzyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-tert-butylthiourea |
|---|---|
| PubChem CID | 91302453 |
| Molecular Formula | C27H35N3O2S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 1-[(3aS,6R,7aR)-3a-(1,3-benzodioxol-5-yl)-1-benzyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-tert-butylthiourea |
| SMILES | CC(C)(C)NC(=S)N[C@@H]1CC[C@@]2(c3ccc4c(c3)OCO4)CCN(Cc3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C27H35N3O2S/c1-26(2,3)29-25(33)28-21-11-12-27(20-9-10-22-23(15-20)32-18-31-22)13-14-30(24(27)16-21)17-19-7-5-4-6-8-19/h4-10,15,21,24H,11-14,16-18H2,1-3H3,(H2,28,29,33)/t21-,24-,27+/m1/s1 |
| InChIKey | QPGURLRDBDHPPN-DBTWGZIYSA-N |
| XLogP | 4.74 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|