C26H32ClN3O3 — CID 11259941
1-[(3aS,6R,7aS)-3a-(1,3-benzodioxol-5-yl)-1-benzyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-prop-2-enylurea;hydrochloride (PubChem CID 11259941) has the molecular formula C26H32ClN3O3 and a molecular weight of 470.01 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(1,3-benzodioxol-5-yl)-1-benzyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-prop-2-enylurea;hydrochloride.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(1,3-benzodioxol-5-yl)-1-benzyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-prop-2-enylurea;hydrochloride |
|---|---|
| PubChem CID | 11259941 |
| Molecular Formula | C26H32ClN3O3 |
| Molecular Weight | 470.01 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(1,3-benzodioxol-5-yl)-1-benzyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-prop-2-enylurea;hydrochloride |
| SMILES | C=CCNC(=O)N[C@@H]1CC[C@@]2(c3ccc4c(c3)OCO4)CCN(Cc3ccccc3)[C@H]2C1.Cl |
| InChI | InChI=1S/C26H31N3O3.ClH/c1-2-13-27-25(30)28-21-10-11-26(20-8-9-22-23(15-20)32-18-31-22)12-14-29(24(26)16-21)17-19-6-4-3-5-7-19;/h2-9,15,21,24H,1,10-14,16-18H2,(H2,27,28,30);1H/t21-,24+,26+;/m1./s1 |
| InChIKey | LNXNMGKCDUPRDP-HZKQAOHMSA-N |
| XLogP | 4.39 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.01 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|