C30H38F4N4O3 — CID 91071359
1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-(1-methylpiperidin-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 91071359) has the molecular formula C30H38F4N4O3 and a molecular weight of 578.65 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-(1-methylpiperidin-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-(1-methylpiperidin-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 91071359 |
| Molecular Formula | C30H38F4N4O3 |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-(1-methylpiperidin-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)Nc4cc(F)cc(C(F)(F)F)c4)C[C@H]2N(C2CCN(C)CC2)CC3)cc1OC |
| InChI | InChI=1S/C30H38F4N4O3/c1-37-11-7-24(8-12-37)38-13-10-29(19-4-5-25(40-2)26(16-19)41-3)9-6-22(18-27(29)38)35-28(39)36-23-15-20(30(32,33)34)14-21(31)17-23/h4-5,14-17,22,24,27H,6-13,18H2,1-3H3,(H2,35,36,39)/t22-,27+,29-/m0/s1 |
| InChIKey | SVADDCRRVYUMKO-JWMKGCOUSA-N |
| XLogP | 5.64 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |