C30H39F3N4O3 — CID 87980617
1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(1-methylpiperidin-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 87980617) has the molecular formula C30H39F3N4O3 and a molecular weight of 560.66 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(1-methylpiperidin-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(1-methylpiperidin-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 87980617 |
| Molecular Formula | C30H39F3N4O3 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(1-methylpiperidin-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)Nc4ccc(C(F)(F)F)cc4)C[C@@H]2N(C2CCN(C)CC2)CC3)cc1OC |
| InChI | InChI=1S/C30H39F3N4O3/c1-36-15-11-24(12-16-36)37-17-14-29(21-6-9-25(39-2)26(18-21)40-3)13-10-23(19-27(29)37)35-28(38)34-22-7-4-20(5-8-22)30(31,32)33/h4-9,18,23-24,27H,10-17,19H2,1-3H3,(H2,34,35,38)/t23-,27+,29+/m1/s1 |
| InChIKey | GHODXXAPJOICJZ-OVTKCHPXSA-N |
| XLogP | 5.50 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |