C29H36F3N3O4 — CID 87979396
1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(oxan-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 87979396) has the molecular formula C29H36F3N3O4 and a molecular weight of 547.62 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(oxan-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(oxan-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 87979396 |
| Molecular Formula | C29H36F3N3O4 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(oxan-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)Nc4cccc(C(F)(F)F)c4)C[C@@H]2N(C2CCOCC2)CC3)cc1OC |
| InChI | InChI=1S/C29H36F3N3O4/c1-37-24-7-6-19(17-25(24)38-2)28-11-8-22(18-26(28)35(13-12-28)23-9-14-39-15-10-23)34-27(36)33-21-5-3-4-20(16-21)29(30,31)32/h3-7,16-17,22-23,26H,8-15,18H2,1-2H3,(H2,33,34,36)/t22-,26+,28+/m1/s1 |
| InChIKey | PVUUJCSYMMXVJD-ZEZZXZOMSA-N |
| XLogP | 5.59 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |