C27H34F3N3O3 — CID 87980824
1-[3a-(3,4-dimethoxyphenyl)-1-propan-2-yl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 87980824) has the molecular formula C27H34F3N3O3 and a molecular weight of 505.58 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-propan-2-yl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-propan-2-yl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 87980824 |
| Molecular Formula | C27H34F3N3O3 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-propan-2-yl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4ccc(C(F)(F)F)cc4)CC2N(C(C)C)CC3)cc1OC |
| InChI | InChI=1S/C27H34F3N3O3/c1-17(2)33-14-13-26(19-7-10-22(35-3)23(15-19)36-4)12-11-21(16-24(26)33)32-25(34)31-20-8-5-18(6-9-20)27(28,29)30/h5-10,15,17,21,24H,11-14,16H2,1-4H3,(H2,31,32,34) |
| InChIKey | JKXIORZUBFKUFQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |