C26H29F6N3O5 — CID 11959921
1-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(2,3,4-trifluorophenyl)urea;2,2,2-trifluoroacetic acid (PubChem CID 11959921) has the molecular formula C26H29F6N3O5 and a molecular weight of 577.52 g/mol. Its IUPAC name is 1-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(2,3,4-trifluorophenyl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(2,3,4-trifluorophenyl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11959921 |
| Molecular Formula | C26H29F6N3O5 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 1-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(2,3,4-trifluorophenyl)urea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)Nc4ccc(F)c(F)c4F)C[C@@H]2CN(C)C3)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H28F3N3O3.C2HF3O2/c1-30-12-15-10-16(28-23(31)29-18-6-5-17(25)21(26)22(18)27)8-9-24(15,13-30)14-4-7-19(32-2)20(11-14)33-3;3-2(4,5)1(6)7/h4-7,11,15-16H,8-10,12-13H2,1-3H3,(H2,28,29,31);(H,6,7)/t15-,16-,24+;/m1./s1 |
| InChIKey | RRNKAPCUDZPAQG-ZHMRBPTBSA-N |
| XLogP | 4.93 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|