C25H29F4N3O3 — CID 11960198
1-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea (PubChem CID 11960198) has the molecular formula C25H29F4N3O3 and a molecular weight of 495.52 g/mol. Its IUPAC name is 1-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 11960198 |
| Molecular Formula | C25H29F4N3O3 |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 1-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)Nc4ccc(F)c(C(F)(F)F)c4)C[C@@H]2CN(C)C3)cc1OC |
| InChI | InChI=1S/C25H29F4N3O3/c1-32-13-16-10-18(31-23(33)30-17-5-6-20(26)19(12-17)25(27,28)29)8-9-24(16,14-32)15-4-7-21(34-2)22(11-15)35-3/h4-7,11-12,16,18H,8-10,13-14H2,1-3H3,(H2,30,31,33)/t16-,18-,24+/m1/s1 |
| InChIKey | AFUXOPHOMDRSSC-OSWMTFESSA-N |
| XLogP | 5.04 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |