C24H30FN3O3 — CID 69440689
1-[7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(3-fluorophenyl)urea (PubChem CID 69440689) has the molecular formula C24H30FN3O3 and a molecular weight of 427.52 g/mol. Its IUPAC name is 1-[7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 69440689 |
| Molecular Formula | C24H30FN3O3 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 1-[7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(3-fluorophenyl)urea |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4cccc(F)c4)CC2CN(C)C3)cc1OC |
| InChI | InChI=1S/C24H30FN3O3/c1-28-14-17-11-20(27-23(29)26-19-6-4-5-18(25)13-19)9-10-24(17,15-28)16-7-8-21(30-2)22(12-16)31-3/h4-8,12-13,17,20H,9-11,14-15H2,1-3H3,(H2,26,27,29) |
| InChIKey | UAPSGGIIIFNFQE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |