C23H29N3O3 — CID 143317126
N-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]pyridine-4-carboxamide (PubChem CID 143317126) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]pyridine-4-carboxamide.
| Compound Name | N-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 143317126 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]pyridine-4-carboxamide |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)c4ccncc4)C[C@@H]2CN(C)C3)cc1OC |
| InChI | InChI=1S/C23H29N3O3/c1-26-14-18-12-19(25-22(27)16-7-10-24-11-8-16)6-9-23(18,15-26)17-4-5-20(28-2)21(13-17)29-3/h4-5,7-8,10-11,13,18-19H,6,9,12,14-15H2,1-3H3,(H,25,27)/t18-,19-,23+/m1/s1 |
| InChIKey | YXRZLJLJIWTRNP-PWHSHALESA-N |
| XLogP | 2.88 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |