C25H28F4N2O3 — CID 11960622
N-[(3aS,5S,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-fluoro-4-(trifluoromethyl)benzamide (PubChem CID 11960622) has the molecular formula C25H28F4N2O3 and a molecular weight of 480.50 g/mol. Its IUPAC name is N-[(3aS,5S,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-fluoro-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(3aS,5S,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-fluoro-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 11960622 |
| Molecular Formula | C25H28F4N2O3 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-[(3aS,5S,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-fluoro-4-(trifluoromethyl)benzamide |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)c4ccc(C(F)(F)F)c(F)c4)C[C@@H]2CN(C)C3)cc1OC |
| InChI | InChI=1S/C25H28F4N2O3/c1-31-13-17-11-18(30-23(32)15-4-6-19(20(26)10-15)25(27,28)29)8-9-24(17,14-31)16-5-7-21(33-2)22(12-16)34-3/h4-7,10,12,17-18H,8-9,11,13-14H2,1-3H3,(H,30,32)/t17-,18+,24+/m1/s1 |
| InChIKey | BFXIHSPMKSOQFN-YTZAWJCFSA-N |
| XLogP | 4.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |