C25H30F2N2O3S — CID 90790748
N-[(3aS,5S,7aS)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(difluoromethylsulfanyl)benzamide (PubChem CID 90790748) has the molecular formula C25H30F2N2O3S and a molecular weight of 476.59 g/mol. Its IUPAC name is N-[(3aS,5S,7aS)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(difluoromethylsulfanyl)benzamide.
| Compound Name | N-[(3aS,5S,7aS)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(difluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 90790748 |
| Molecular Formula | C25H30F2N2O3S |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-[(3aS,5S,7aS)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(difluoromethylsulfanyl)benzamide |
| SMILES | COc1ccc([C@]23CC[C@H](NC(=O)c4cccc(SC(F)F)c4)C[C@@H]2CN(C)C3)cc1OC |
| InChI | InChI=1S/C25H30F2N2O3S/c1-29-14-18-12-19(28-23(30)16-5-4-6-20(11-16)33-24(26)27)9-10-25(18,15-29)17-7-8-21(31-2)22(13-17)32-3/h4-8,11,13,18-19,24H,9-10,12,14-15H2,1-3H3,(H,28,30)/t18-,19+,25-/m1/s1 |
| InChIKey | YPGCWWDIRIRTPI-HHJKRLRDSA-N |
| XLogP | 4.80 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |