C24H28F2N2O3 — CID 11960408
N-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-2,5-difluorobenzamide (PubChem CID 11960408) has the molecular formula C24H28F2N2O3 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-2,5-difluorobenzamide.
| Compound Name | N-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 11960408 |
| Molecular Formula | C24H28F2N2O3 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-[(3aS,5R,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-2,5-difluorobenzamide |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)c4cc(F)ccc4F)C[C@@H]2CN(C)C3)cc1OC |
| InChI | InChI=1S/C24H28F2N2O3/c1-28-13-16-10-18(27-23(29)19-12-17(25)5-6-20(19)26)8-9-24(16,14-28)15-4-7-21(30-2)22(11-15)31-3/h4-7,11-12,16,18H,8-10,13-14H2,1-3H3,(H,27,29)/t16-,18-,24+/m1/s1 |
| InChIKey | HOZNVYWDTOHVMX-OSWMTFESSA-N |
| XLogP | 3.76 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |