C24H28ClFN2O3 — CID 143317113
N-[(7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-chloro-2-fluorobenzamide (PubChem CID 143317113) has the molecular formula C24H28ClFN2O3 and a molecular weight of 446.95 g/mol. Its IUPAC name is N-[(7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-chloro-2-fluorobenzamide.
| Compound Name | N-[(7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 143317113 |
| Molecular Formula | C24H28ClFN2O3 |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[(7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-chloro-2-fluorobenzamide |
| SMILES | COc1ccc([C@@]23CCC(NC(=O)c4cccc(Cl)c4F)CC2CN(C)C3)cc1OC |
| InChI | InChI=1S/C24H28ClFN2O3/c1-28-13-16-11-17(27-23(29)18-5-4-6-19(25)22(18)26)9-10-24(16,14-28)15-7-8-20(30-2)21(12-15)31-3/h4-8,12,16-17H,9-11,13-14H2,1-3H3,(H,27,29)/t16?,17?,24-/m0/s1 |
| InChIKey | VWYCMPQBKPHYJI-DFSZNTFHSA-N |
| XLogP | 4.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |