C24H29F2N3O3 — CID 69440812
1-[7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(3,5-difluorophenyl)urea (PubChem CID 69440812) has the molecular formula C24H29F2N3O3 and a molecular weight of 445.51 g/mol. Its IUPAC name is 1-[7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(3,5-difluorophenyl)urea.
| Compound Name | 1-[7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(3,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 69440812 |
| Molecular Formula | C24H29F2N3O3 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 1-[7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3-(3,5-difluorophenyl)urea |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4cc(F)cc(F)c4)CC2CN(C)C3)cc1OC |
| InChI | InChI=1S/C24H29F2N3O3/c1-29-13-16-8-19(27-23(30)28-20-11-17(25)10-18(26)12-20)6-7-24(16,14-29)15-4-5-21(31-2)22(9-15)32-3/h4-5,9-12,16,19H,6-8,13-14H2,1-3H3,(H2,27,28,30) |
| InChIKey | ZOMSSFKVICNADZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |