C26H34N2O5 — CID 69443773
N-[7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3,4-dimethoxybenzamide (PubChem CID 69443773) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-[7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 69443773 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | N-[7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-5-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCC3(c4ccc(OC)c(OC)c4)CN(C)CC3C2)cc1OC |
| InChI | InChI=1S/C26H34N2O5/c1-28-15-19-13-20(27-25(29)17-6-8-21(30-2)23(12-17)32-4)10-11-26(19,16-28)18-7-9-22(31-3)24(14-18)33-5/h6-9,12,14,19-20H,10-11,13,15-16H2,1-5H3,(H,27,29) |
| InChIKey | XZZRAFZRGPDOJN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |