C17H26IN3O2S — CID 177061512
[2-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]hydrazinyl] thiohypoiodite (PubChem CID 177061512) has the molecular formula C17H26IN3O2S and a molecular weight of 463.39 g/mol. Its IUPAC name is [2-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]hydrazinyl] thiohypoiodite.
| Compound Name | [2-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]hydrazinyl] thiohypoiodite |
|---|---|
| PubChem CID | 177061512 |
| Molecular Formula | C17H26IN3O2S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | [2-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]hydrazinyl] thiohypoiodite |
| SMILES | COc1ccc(C23CCC(NNSI)CC2N(C)CC3)cc1OC |
| InChI | InChI=1S/C17H26IN3O2S/c1-21-9-8-17(7-6-13(11-16(17)21)19-20-24-18)12-4-5-14(22-2)15(10-12)23-3/h4-5,10,13,16,19-20H,6-9,11H2,1-3H3 |
| InChIKey | MNIHYFJVIKRCFB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|