C21H31NO3 — CID 171567568
3a-(3,4-dimethoxyphenyl)-1-methyl-5-(2-methylpropyl)-2,3,4,5,7,7a-hexahydroindol-6-one (PubChem CID 171567568) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is 3a-(3,4-dimethoxyphenyl)-1-methyl-5-(2-methylpropyl)-2,3,4,5,7,7a-hexahydroindol-6-one.
| Compound Name | 3a-(3,4-dimethoxyphenyl)-1-methyl-5-(2-methylpropyl)-2,3,4,5,7,7a-hexahydroindol-6-one |
|---|---|
| PubChem CID | 171567568 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 3a-(3,4-dimethoxyphenyl)-1-methyl-5-(2-methylpropyl)-2,3,4,5,7,7a-hexahydroindol-6-one |
| SMILES | COc1ccc(C23CCN(C)C2CC(=O)C(CC(C)C)C3)cc1OC |
| InChI | InChI=1S/C21H31NO3/c1-14(2)10-15-13-21(8-9-22(3)20(21)12-17(15)23)16-6-7-18(24-4)19(11-16)25-5/h6-7,11,14-15,20H,8-10,12-13H2,1-5H3 |
| InChIKey | ZXMPFPFBBBESQE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |