C21H29F2NO2 — CID 171567504
3a-(3,4-dimethoxyphenyl)-3',3'-difluoro-1-methylspiro[2,3,4,5,7,7a-hexahydroindole-6,1'-cyclopentane] (PubChem CID 171567504) has the molecular formula C21H29F2NO2 and a molecular weight of 365.46 g/mol. Its IUPAC name is 3a-(3,4-dimethoxyphenyl)-3',3'-difluoro-1-methylspiro[2,3,4,5,7,7a-hexahydroindole-6,1'-cyclopentane].
| Compound Name | 3a-(3,4-dimethoxyphenyl)-3',3'-difluoro-1-methylspiro[2,3,4,5,7,7a-hexahydroindole-6,1'-cyclopentane] |
|---|---|
| PubChem CID | 171567504 |
| Molecular Formula | C21H29F2NO2 |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 3a-(3,4-dimethoxyphenyl)-3',3'-difluoro-1-methylspiro[2,3,4,5,7,7a-hexahydroindole-6,1'-cyclopentane] |
| SMILES | COc1ccc(C23CCN(C)C2CC2(CCC(F)(F)C2)CC3)cc1OC |
| InChI | InChI=1S/C21H29F2NO2/c1-24-11-10-20(15-4-5-16(25-2)17(12-15)26-3)8-6-19(13-18(20)24)7-9-21(22,23)14-19/h4-5,12,18H,6-11,13-14H2,1-3H3 |
| InChIKey | BOMOPESRYYMBJL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |