C21H32N2O2 — CID 171567378
3a-(3,4-dimethoxyphenyl)-1,1'-dimethylspiro[2,3,4,5,7,7a-hexahydroindole-6,2'-pyrrolidine] (PubChem CID 171567378) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 3a-(3,4-dimethoxyphenyl)-1,1'-dimethylspiro[2,3,4,5,7,7a-hexahydroindole-6,2'-pyrrolidine].
| Compound Name | 3a-(3,4-dimethoxyphenyl)-1,1'-dimethylspiro[2,3,4,5,7,7a-hexahydroindole-6,2'-pyrrolidine] |
|---|---|
| PubChem CID | 171567378 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 3a-(3,4-dimethoxyphenyl)-1,1'-dimethylspiro[2,3,4,5,7,7a-hexahydroindole-6,2'-pyrrolidine] |
| SMILES | COc1ccc(C23CCN(C)C2CC2(CCCN2C)CC3)cc1OC |
| InChI | InChI=1S/C21H32N2O2/c1-22-13-11-21(16-6-7-17(24-3)18(14-16)25-4)10-9-20(15-19(21)22)8-5-12-23(20)2/h6-7,14,19H,5,8-13,15H2,1-4H3 |
| InChIKey | GHOCDCMKNQNQLR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |