C22H31F2NO2 — CID 171567616
3a-(3,4-dimethoxyphenyl)-1',1'-difluoro-1-methylspiro[2,3,4,5,7,7a-hexahydroindole-6,3'-cyclohexane] (PubChem CID 171567616) has the molecular formula C22H31F2NO2 and a molecular weight of 379.49 g/mol. Its IUPAC name is 3a-(3,4-dimethoxyphenyl)-1',1'-difluoro-1-methylspiro[2,3,4,5,7,7a-hexahydroindole-6,3'-cyclohexane].
| Compound Name | 3a-(3,4-dimethoxyphenyl)-1',1'-difluoro-1-methylspiro[2,3,4,5,7,7a-hexahydroindole-6,3'-cyclohexane] |
|---|---|
| PubChem CID | 171567616 |
| Molecular Formula | C22H31F2NO2 |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 3a-(3,4-dimethoxyphenyl)-1',1'-difluoro-1-methylspiro[2,3,4,5,7,7a-hexahydroindole-6,3'-cyclohexane] |
| SMILES | COc1ccc(C23CCN(C)C2CC2(CCCC(F)(F)C2)CC3)cc1OC |
| InChI | InChI=1S/C22H31F2NO2/c1-25-12-11-21(16-5-6-17(26-2)18(13-16)27-3)10-9-20(14-19(21)25)7-4-8-22(23,24)15-20/h5-6,13,19H,4,7-12,14-15H2,1-3H3 |
| InChIKey | DKVYGXUPVXMUTO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |