C20H28N2O3 — CID 171567422
3a-(3,4-dimethoxyphenyl)-1,1'-dimethylspiro[2,3,4,5,7,7a-hexahydroindole-6,4'-azetidine]-2'-one (PubChem CID 171567422) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 3a-(3,4-dimethoxyphenyl)-1,1'-dimethylspiro[2,3,4,5,7,7a-hexahydroindole-6,4'-azetidine]-2'-one.
| Compound Name | 3a-(3,4-dimethoxyphenyl)-1,1'-dimethylspiro[2,3,4,5,7,7a-hexahydroindole-6,4'-azetidine]-2'-one |
|---|---|
| PubChem CID | 171567422 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 3a-(3,4-dimethoxyphenyl)-1,1'-dimethylspiro[2,3,4,5,7,7a-hexahydroindole-6,4'-azetidine]-2'-one |
| SMILES | COc1ccc(C23CCN(C)C2CC2(CC3)CC(=O)N2C)cc1OC |
| InChI | InChI=1S/C20H28N2O3/c1-21-10-9-20(14-5-6-15(24-3)16(11-14)25-4)8-7-19(12-17(20)21)13-18(23)22(19)2/h5-6,11,17H,7-10,12-13H2,1-4H3 |
| InChIKey | XZWREMBESCHNDP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |