C17H21F2NO3 — CID 176591968
(3aR,6R,7aS)-3a-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol (PubChem CID 176591968) has the molecular formula C17H21F2NO3 and a molecular weight of 325.36 g/mol. Its IUPAC name is (3aR,6R,7aS)-3a-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol.
| Compound Name | (3aR,6R,7aS)-3a-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol |
|---|---|
| PubChem CID | 176591968 |
| Molecular Formula | C17H21F2NO3 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (3aR,6R,7aS)-3a-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol |
| SMILES | COc1cc([C@@]23C=C[C@H](O)C[C@@H]2N(C)CC3)ccc1OC(F)F |
| InChI | InChI=1S/C17H21F2NO3/c1-20-8-7-17(6-5-12(21)10-15(17)20)11-3-4-13(23-16(18)19)14(9-11)22-2/h3-6,9,12,15-16,21H,7-8,10H2,1-2H3/t12-,15-,17-/m0/s1 |
| InChIKey | BSOPHJWERUKCQQ-NUTKFTJISA-N |
| XLogP | 2.56 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|