C20H27NO4 — CID 177078186
[(3aR,6S,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-yl] propanoate (PubChem CID 177078186) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is [(3aR,6S,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-yl] propanoate.
| Compound Name | [(3aR,6S,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-yl] propanoate |
|---|---|
| PubChem CID | 177078186 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | [(3aR,6S,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1C=C[C@@]2(c3ccc(OC)c(OC)c3)CCN(C)[C@H]2C1 |
| InChI | InChI=1S/C20H27NO4/c1-5-19(22)25-15-8-9-20(10-11-21(2)18(20)13-15)14-6-7-16(23-3)17(12-14)24-4/h6-9,12,15,18H,5,10-11,13H2,1-4H3/t15-,18+,20+/m1/s1 |
| InChIKey | UVHAHPLHWBPNMN-BPAFIMBUSA-N |
| XLogP | 2.93 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|