C21H31NO4 — CID 171823907
[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl] 2-methylpropanoate (PubChem CID 171823907) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is [(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl] 2-methylpropanoate.
| Compound Name | [(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 171823907 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | [(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl] 2-methylpropanoate |
| SMILES | COc1ccc([C@@]23CC[C@@H](OC(=O)C(C)C)C[C@@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C21H31NO4/c1-14(2)20(23)26-16-8-9-21(10-11-22(3)19(21)13-16)15-6-7-17(24-4)18(12-15)25-5/h6-7,12,14,16,19H,8-11,13H2,1-5H3/t16-,19+,21+/m1/s1 |
| InChIKey | OAYWQPAYOLOMGM-PBEJRMEISA-N |
| XLogP | 3.40 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |