C24H29NO4 — CID 171823893
[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl] benzoate (PubChem CID 171823893) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is [(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl] benzoate.
| Compound Name | [(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl] benzoate |
|---|---|
| PubChem CID | 171823893 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl] benzoate |
| SMILES | COc1ccc([C@@]23CC[C@@H](OC(=O)c4ccccc4)C[C@@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C24H29NO4/c1-25-14-13-24(18-9-10-20(27-2)21(15-18)28-3)12-11-19(16-22(24)25)29-23(26)17-7-5-4-6-8-17/h4-10,15,19,22H,11-14,16H2,1-3H3/t19-,22+,24+/m1/s1 |
| InChIKey | SVBKJFJDZHTCBJ-UCFCWBNQSA-N |
| XLogP | 4.06 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |