C24H29Cl2N3O3S — CID 87979411
1-[[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]sulfanyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 87979411) has the molecular formula C24H29Cl2N3O3S and a molecular weight of 510.49 g/mol. Its IUPAC name is 1-[[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]sulfanyl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]sulfanyl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 87979411 |
| Molecular Formula | C24H29Cl2N3O3S |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 1-[[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]sulfanyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | COc1ccc(C23CCC(SNC(=O)Nc4cccc(Cl)c4Cl)CC2N(C)CC3)cc1OC |
| InChI | InChI=1S/C24H29Cl2N3O3S/c1-29-12-11-24(15-7-8-19(31-2)20(13-15)32-3)10-9-16(14-21(24)29)33-28-23(30)27-18-6-4-5-17(25)22(18)26/h4-8,13,16,21H,9-12,14H2,1-3H3,(H2,27,28,30) |
| InChIKey | IXFMPSYKSGOCSE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|