C21H29NO2S — CID 176591984
(3aR,6S,7aS)-3a-(3-cyclopentylsulfanyl-4-methoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol (PubChem CID 176591984) has the molecular formula C21H29NO2S and a molecular weight of 359.54 g/mol. Its IUPAC name is (3aR,6S,7aS)-3a-(3-cyclopentylsulfanyl-4-methoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol.
| Compound Name | (3aR,6S,7aS)-3a-(3-cyclopentylsulfanyl-4-methoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol |
|---|---|
| PubChem CID | 176591984 |
| Molecular Formula | C21H29NO2S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (3aR,6S,7aS)-3a-(3-cyclopentylsulfanyl-4-methoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol |
| SMILES | COc1ccc([C@@]23C=C[C@@H](O)C[C@@H]2N(C)CC3)cc1SC1CCCC1 |
| InChI | InChI=1S/C21H29NO2S/c1-22-12-11-21(10-9-16(23)14-20(21)22)15-7-8-18(24-2)19(13-15)25-17-5-3-4-6-17/h7-10,13,16-17,20,23H,3-6,11-12,14H2,1-2H3/t16-,20+,21+/m1/s1 |
| InChIKey | CLYJZSXCBWVFDY-CZAAIQMYSA-N |
| XLogP | 3.99 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|