C18H27NO2S — CID 176592056
(3aS,6R,7aS)-3a-(3-ethylsulfanyl-4-methoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol (PubChem CID 176592056) has the molecular formula C18H27NO2S and a molecular weight of 321.49 g/mol. Its IUPAC name is (3aS,6R,7aS)-3a-(3-ethylsulfanyl-4-methoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol.
| Compound Name | (3aS,6R,7aS)-3a-(3-ethylsulfanyl-4-methoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
|---|---|
| PubChem CID | 176592056 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (3aS,6R,7aS)-3a-(3-ethylsulfanyl-4-methoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
| SMILES | CCSc1cc([C@@]23CC[C@@H](O)C[C@@H]2N(C)CC3)ccc1OC |
| InChI | InChI=1S/C18H27NO2S/c1-4-22-16-11-13(5-6-15(16)21-3)18-8-7-14(20)12-17(18)19(2)10-9-18/h5-6,11,14,17,20H,4,7-10,12H2,1-3H3/t14-,17+,18+/m1/s1 |
| InChIKey | SMOIZSCFWOBLRQ-JLSDUUJJSA-N |
| XLogP | 3.29 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |