C17H24INO3 — CID 176592074
(3aS,6S,7aS)-3a-(3-iodo-4,5-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol (PubChem CID 176592074) has the molecular formula C17H24INO3 and a molecular weight of 417.29 g/mol. Its IUPAC name is (3aS,6S,7aS)-3a-(3-iodo-4,5-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol.
| Compound Name | (3aS,6S,7aS)-3a-(3-iodo-4,5-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
|---|---|
| PubChem CID | 176592074 |
| Molecular Formula | C17H24INO3 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | (3aS,6S,7aS)-3a-(3-iodo-4,5-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
| SMILES | COc1cc([C@@]23CC[C@H](O)C[C@@H]2N(C)CC3)cc(I)c1OC |
| InChI | InChI=1S/C17H24INO3/c1-19-7-6-17(5-4-12(20)10-15(17)19)11-8-13(18)16(22-3)14(9-11)21-2/h8-9,12,15,20H,4-7,10H2,1-3H3/t12-,15-,17-/m0/s1 |
| InChIKey | GJSQFAOLLAUQIU-NUTKFTJISA-N |
| XLogP | 2.80 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|