C23H35NO5 — CID 11047783
tert-butyl (3aS,6S,7aS)-6-hydroxy-3a-(3-methoxy-4-propan-2-yloxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate (PubChem CID 11047783) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl (3aS,6S,7aS)-6-hydroxy-3a-(3-methoxy-4-propan-2-yloxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate.
| Compound Name | tert-butyl (3aS,6S,7aS)-6-hydroxy-3a-(3-methoxy-4-propan-2-yloxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 11047783 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | tert-butyl (3aS,6S,7aS)-6-hydroxy-3a-(3-methoxy-4-propan-2-yloxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
| SMILES | COc1cc([C@@]23CC[C@H](O)C[C@@H]2N(C(=O)OC(C)(C)C)CC3)ccc1OC(C)C |
| InChI | InChI=1S/C23H35NO5/c1-15(2)28-18-8-7-16(13-19(18)27-6)23-10-9-17(25)14-20(23)24(12-11-23)21(26)29-22(3,4)5/h7-8,13,15,17,20,25H,9-12,14H2,1-6H3/t17-,20-,23-/m0/s1 |
| InChIKey | IXJZQWZTHJUHNH-NYDSKATKSA-N |
| XLogP | 4.27 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |