C18H25NO4 — CID 10781901
methyl (3aS,7aS)-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate (PubChem CID 10781901) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is methyl (3aS,7aS)-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate.
| Compound Name | methyl (3aS,7aS)-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 10781901 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | methyl (3aS,7aS)-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
| SMILES | COC(=O)N1CC[C@]2(c3ccc(OC)c(OC)c3)CCCC[C@H]12 |
| InChI | InChI=1S/C18H25NO4/c1-21-14-8-7-13(12-15(14)22-2)18-9-5-4-6-16(18)19(11-10-18)17(20)23-3/h7-8,12,16H,4-6,9-11H2,1-3H3/t16-,18-/m0/s1 |
| InChIKey | DCHWZHSVGPKGQH-WMZOPIPTSA-N |
| XLogP | 3.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |