C16H23NO2 — CID 85196191
3a-(3,4-dimethoxyphenyl)-1,2,3,4,5,6,7,7a-octahydroindole (PubChem CID 85196191) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 3a-(3,4-dimethoxyphenyl)-1,2,3,4,5,6,7,7a-octahydroindole.
| Compound Name | 3a-(3,4-dimethoxyphenyl)-1,2,3,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 85196191 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 3a-(3,4-dimethoxyphenyl)-1,2,3,4,5,6,7,7a-octahydroindole |
| SMILES | COc1ccc(C23CCCCC2NCC3)cc1OC |
| InChI | InChI=1S/C16H23NO2/c1-18-13-7-6-12(11-14(13)19-2)16-8-4-3-5-15(16)17-10-9-16/h6-7,11,15,17H,3-5,8-10H2,1-2H3 |
| InChIKey | SZMTUPCIFXIGLZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |