C14H20O3 — CID 13128207
[1-(3,4-dimethoxyphenyl)cyclopentyl]methanol (PubChem CID 13128207) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is [1-(3,4-dimethoxyphenyl)cyclopentyl]methanol.
| Compound Name | [1-(3,4-dimethoxyphenyl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 13128207 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | [1-(3,4-dimethoxyphenyl)cyclopentyl]methanol |
| SMILES | COc1ccc(C2(CO)CCCC2)cc1OC |
| InChI | InChI=1S/C14H20O3/c1-16-12-6-5-11(9-13(12)17-2)14(10-15)7-3-4-8-14/h5-6,9,15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | NTVYWJWIOCGJFA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |