C18H24NO5- — CID 3678737
4-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methylamino]-4-oxobutanoate (PubChem CID 3678737) has the molecular formula C18H24NO5- and a molecular weight of 334.39 g/mol. Its IUPAC name is 4-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methylamino]-4-oxobutanoate.
| Compound Name | 4-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 3678737 |
| Molecular Formula | C18H24NO5- |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 4-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methylamino]-4-oxobutanoate |
| SMILES | COc1ccc(C2(CNC(=O)CCC(=O)[O-])CCCC2)cc1OC |
| InChI | InChI=1S/C18H25NO5/c1-23-14-6-5-13(11-15(14)24-2)18(9-3-4-10-18)12-19-16(20)7-8-17(21)22/h5-6,11H,3-4,7-10,12H2,1-2H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | XGAFAVGNPVXMPM-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |