C23H26FNO3 — CID 1322060
(E)-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 1322060) has the molecular formula C23H26FNO3 and a molecular weight of 383.46 g/mol. Its IUPAC name is (E)-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1322060 |
| Molecular Formula | C23H26FNO3 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (E)-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | COc1ccc(C2(CNC(=O)/C=C/c3ccc(F)cc3)CCCC2)cc1OC |
| InChI | InChI=1S/C23H26FNO3/c1-27-20-11-8-18(15-21(20)28-2)23(13-3-4-14-23)16-25-22(26)12-7-17-5-9-19(24)10-6-17/h5-12,15H,3-4,13-14,16H2,1-2H3,(H,25,26)/b12-7+ |
| InChIKey | ODYAVNHBNWFODC-KPKJPENVSA-N |
| XLogP | 4.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|