C24H28BrNO4 — CID 74526798
3-(5-bromo-2-methoxyphenyl)-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]prop-2-enamide (PubChem CID 74526798) has the molecular formula C24H28BrNO4 and a molecular weight of 474.40 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxyphenyl)-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]prop-2-enamide.
| Compound Name | 3-(5-bromo-2-methoxyphenyl)-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 74526798 |
| Molecular Formula | C24H28BrNO4 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 3-(5-bromo-2-methoxyphenyl)-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]prop-2-enamide |
| SMILES | COc1ccc(Br)cc1C=CC(=O)NCC1(c2ccc(OC)c(OC)c2)CCCC1 |
| InChI | InChI=1S/C24H28BrNO4/c1-28-20-10-8-19(25)14-17(20)6-11-23(27)26-16-24(12-4-5-13-24)18-7-9-21(29-2)22(15-18)30-3/h6-11,14-15H,4-5,12-13,16H2,1-3H3,(H,26,27) |
| InChIKey | VYMDAIUEUOIQIQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|