C22H24BrNO3 — CID 1095830
(E)-3-(5-bromo-2-methoxyphenyl)-N-[(4-phenyloxan-4-yl)methyl]prop-2-enamide (PubChem CID 1095830) has the molecular formula C22H24BrNO3 and a molecular weight of 430.34 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-[(4-phenyloxan-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-[(4-phenyloxan-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 1095830 |
| Molecular Formula | C22H24BrNO3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-[(4-phenyloxan-4-yl)methyl]prop-2-enamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)NCC1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C22H24BrNO3/c1-26-20-9-8-19(23)15-17(20)7-10-21(25)24-16-22(11-13-27-14-12-22)18-5-3-2-4-6-18/h2-10,15H,11-14,16H2,1H3,(H,24,25)/b10-7+ |
| InChIKey | COEHUQNDQGMISK-JXMROGBWSA-N |
| XLogP | 4.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|