C20H22BrNO3S — CID 60578306
(E)-3-(5-bromothiophen-2-yl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]prop-2-enamide (PubChem CID 60578306) has the molecular formula C20H22BrNO3S and a molecular weight of 436.37 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 60578306 |
| Molecular Formula | C20H22BrNO3S |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]prop-2-enamide |
| SMILES | COc1ccc(C2(CNC(=O)/C=C/c3ccc(Br)s3)CCOCC2)cc1 |
| InChI | InChI=1S/C20H22BrNO3S/c1-24-16-4-2-15(3-5-16)20(10-12-25-13-11-20)14-22-19(23)9-7-17-6-8-18(21)26-17/h2-9H,10-14H2,1H3,(H,22,23)/b9-7+ |
| InChIKey | IRDVSLOHASJWOQ-VQHVLOKHSA-N |
| XLogP | 4.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|