C24H29NO4 — CID 94650415
(E)-3-(4-ethoxyphenyl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]prop-2-enamide (PubChem CID 94650415) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-ethoxyphenyl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 94650415 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)NCC2(c3ccc(OC)cc3)CCOCC2)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-3-29-22-9-4-19(5-10-22)6-13-23(26)25-18-24(14-16-28-17-15-24)20-7-11-21(27-2)12-8-20/h4-13H,3,14-18H2,1-2H3,(H,25,26)/b13-6+ |
| InChIKey | XPJABBAYQOMNSC-AWNIVKPZSA-N |
| XLogP | 3.97 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|