C25H31NO4 — CID 71964859
N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-3-(4-propan-2-yloxyphenyl)prop-2-enamide (PubChem CID 71964859) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-3-(4-propan-2-yloxyphenyl)prop-2-enamide.
| Compound Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-3-(4-propan-2-yloxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 71964859 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-3-(4-propan-2-yloxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C2(CNC(=O)C=Cc3ccc(OC(C)C)cc3)CCOCC2)cc1 |
| InChI | InChI=1S/C25H31NO4/c1-19(2)30-23-9-4-20(5-10-23)6-13-24(27)26-18-25(14-16-29-17-15-25)21-7-11-22(28-3)12-8-21/h4-13,19H,14-18H2,1-3H3,(H,26,27) |
| InChIKey | LBPQEPVXFILJBV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|