C17H21NO5 — CID 91338465
1-[[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]methyl]cyclobutane-1-carboxylic acid (PubChem CID 91338465) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-[[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 91338465 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-[[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]methyl]cyclobutane-1-carboxylic acid |
| SMILES | COc1ccc(C=CC(=O)NCC2(C(=O)O)CCC2)cc1OC |
| InChI | InChI=1S/C17H21NO5/c1-22-13-6-4-12(10-14(13)23-2)5-7-15(19)18-11-17(16(20)21)8-3-9-17/h4-7,10H,3,8-9,11H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | WKOXDMMHMRNLDG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|