C22H27NO4 — CID 90599553
(E)-3-(3,4-dimethoxyphenyl)-N-(2-methoxy-2-phenylbutyl)prop-2-enamide (PubChem CID 90599553) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-(2-methoxy-2-phenylbutyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-(2-methoxy-2-phenylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 90599553 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-(2-methoxy-2-phenylbutyl)prop-2-enamide |
| SMILES | CCC(CNC(=O)/C=C/c1ccc(OC)c(OC)c1)(OC)c1ccccc1 |
| InChI | InChI=1S/C22H27NO4/c1-5-22(27-4,18-9-7-6-8-10-18)16-23-21(24)14-12-17-11-13-19(25-2)20(15-17)26-3/h6-15H,5,16H2,1-4H3,(H,23,24)/b14-12+ |
| InChIKey | UFZQTQSEIAUJTC-WYMLVPIESA-N |
| XLogP | 3.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|