C15H18N2O3 — CID 115445885
1-[[[(E)-3-(3-aminophenyl)prop-2-enoyl]amino]methyl]cyclobutane-1-carboxylic acid (PubChem CID 115445885) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-[[[(E)-3-(3-aminophenyl)prop-2-enoyl]amino]methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[[(E)-3-(3-aminophenyl)prop-2-enoyl]amino]methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115445885 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-[[[(E)-3-(3-aminophenyl)prop-2-enoyl]amino]methyl]cyclobutane-1-carboxylic acid |
| SMILES | Nc1cccc(/C=C/C(=O)NCC2(C(=O)O)CCC2)c1 |
| InChI | InChI=1S/C15H18N2O3/c16-12-4-1-3-11(9-12)5-6-13(18)17-10-15(14(19)20)7-2-8-15/h1,3-6,9H,2,7-8,10,16H2,(H,17,18)(H,19,20)/b6-5+ |
| InChIKey | KGKIDZKBSCOUAE-AATRIKPKSA-N |
| XLogP | 1.65 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|